C26H23N5O — CID 177076997
3-[1-(8-amino-2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-3-yl]-1-methylcyclobutan-1-ol (PubChem CID 177076997) has the molecular formula C26H23N5O and a molecular weight of 421.50 g/mol. Its IUPAC name is 3-[1-(8-amino-2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-3-yl]-1-methylcyclobutan-1-ol.
| Compound Name | 3-[1-(8-amino-2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-3-yl]-1-methylcyclobutan-1-ol |
|---|---|
| PubChem CID | 177076997 |
| Molecular Formula | C26H23N5O |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 3-[1-(8-amino-2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-3-yl]-1-methylcyclobutan-1-ol |
| SMILES | CC1(O)CC(c2nc(-c3ccc4ccc(-c5ccccc5)nc4c3N)c3cnccn23)C1 |
| InChI | InChI=1S/C26H23N5O/c1-26(32)13-18(14-26)25-30-24(21-15-28-11-12-31(21)25)19-9-7-17-8-10-20(29-23(17)22(19)27)16-5-3-2-4-6-16/h2-12,15,18,32H,13-14,27H2,1H3 |
| InChIKey | AIOJGGVRSISLKO-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 89.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|