C26H24N5O+ — CID 66715173
3-[8-amino-1-(2-phenylquinolin-7-yl)-2H-imidazo[1,5-a]pyrazin-4-ium-3-yl]-1-methylcyclobutan-1-ol (PubChem CID 66715173) has the molecular formula C26H24N5O+ and a molecular weight of 422.51 g/mol. Its IUPAC name is 3-[8-amino-1-(2-phenylquinolin-7-yl)-2H-imidazo[1,5-a]pyrazin-4-ium-3-yl]-1-methylcyclobutan-1-ol.
| Compound Name | 3-[8-amino-1-(2-phenylquinolin-7-yl)-2H-imidazo[1,5-a]pyrazin-4-ium-3-yl]-1-methylcyclobutan-1-ol |
|---|---|
| PubChem CID | 66715173 |
| Molecular Formula | C26H24N5O+ |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 3-[8-amino-1-(2-phenylquinolin-7-yl)-2H-imidazo[1,5-a]pyrazin-4-ium-3-yl]-1-methylcyclobutan-1-ol |
| SMILES | CC1(O)CC(c2[nH]c(-c3ccc4ccc(-c5ccccc5)nc4c3)c3c(N)ncc[n+]23)C1 |
| InChI | InChI=1S/C26H23N5O/c1-26(32)14-19(15-26)25-30-22(23-24(27)28-11-12-31(23)25)18-8-7-17-9-10-20(29-21(17)13-18)16-5-3-2-4-6-16/h2-13,19,32H,14-15H2,1H3,(H2,27,28)/p+1 |
| InChIKey | PKCDDUHJAFVJJB-UHFFFAOYSA-O |
| XLogP | 4.24 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|