C50H28N4O — CID 177077363
6-(6-isocyano-9-phenylcarbazol-3-yl)-9-[9-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-2-yl]carbazole-3-carbonitrile (PubChem CID 177077363) has the molecular formula C50H28N4O and a molecular weight of 705.83 g/mol. Its IUPAC name is 6-(6-isocyano-9-phenylcarbazol-3-yl)-9-[9-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-2-yl]carbazole-3-carbonitrile.
| Compound Name | 6-(6-isocyano-9-phenylcarbazol-3-yl)-9-[9-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-2-yl]carbazole-3-carbonitrile |
|---|---|
| PubChem CID | 177077363 |
| Molecular Formula | C50H28N4O |
| Molecular Weight | 705.83 g/mol |
| Exact Mass | 705.26 |
| IUPAC Name | 6-(6-isocyano-9-phenylcarbazol-3-yl)-9-[9-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-2-yl]carbazole-3-carbonitrile |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cccc3oc4ccc(-n5c6ccc(C#N)cc6c6cc(-c7ccc8c(c7)c7cc([N+]#[C-])ccc7n8-c7ccccc7)ccc65)cc4c23)c([2H])c1[2H] |
| InChI | InChI=1S/C50H28N4O/c1-52-35-18-23-47-42(28-35)41-27-34(16-21-45(41)53(47)36-11-6-3-7-12-36)33-17-22-46-40(26-33)39-25-31(30-51)15-20-44(39)54(46)37-19-24-48-43(29-37)50-38(13-8-14-49(50)55-48)32-9-4-2-5-10-32/h2-29H/i2D,4D,5D,9D,10D |
| InChIKey | DWNLZUBBEMTZML-ONXRJODMSA-N |
| XLogP | 13.54 |
| TPSA | 51.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.83 |
| LogP ≤ 5 | 13.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|