C26H35N6O2S+ — CID 177082680
N-[3-[4-amino-1-[[4-(aminomethyl)phenyl]methyl]-2-butyl-2H-imidazo[4,5-c]quinolin-1-ium-7-yl]propyl]methanesulfonamide (PubChem CID 177082680) has the molecular formula C26H35N6O2S+ and a molecular weight of 495.67 g/mol. Its IUPAC name is N-[3-[4-amino-1-[[4-(aminomethyl)phenyl]methyl]-2-butyl-2H-imidazo[4,5-c]quinolin-1-ium-7-yl]propyl]methanesulfonamide.
| Compound Name | N-[3-[4-amino-1-[[4-(aminomethyl)phenyl]methyl]-2-butyl-2H-imidazo[4,5-c]quinolin-1-ium-7-yl]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 177082680 |
| Molecular Formula | C26H35N6O2S+ |
| Molecular Weight | 495.67 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | N-[3-[4-amino-1-[[4-(aminomethyl)phenyl]methyl]-2-butyl-2H-imidazo[4,5-c]quinolin-1-ium-7-yl]propyl]methanesulfonamide |
| SMILES | CCCCC1N=c2c(N)nc3cc(CCCNS(C)(=O)=O)ccc3c2=[N+]1Cc1ccc(CN)cc1 |
| InChI | InChI=1S/C26H34N6O2S/c1-3-4-7-23-31-24-25(32(23)17-20-10-8-19(16-27)9-11-20)21-13-12-18(15-22(21)30-26(24)28)6-5-14-29-35(2,33)34/h8-13,15,23,28-29H,3-7,14,16-17,27H2,1-2H3/p+1 |
| InChIKey | SDHQOYNZWQOVOV-UHFFFAOYSA-O |
| XLogP | 1.60 |
| TPSA | 126.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.67 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|