C17H29NO3S2 — CID 57217953
N-[2-(4-octyl-2-sulfanylphenoxy)ethyl]methanesulfonamide (PubChem CID 57217953) has the molecular formula C17H29NO3S2 and a molecular weight of 359.56 g/mol. Its IUPAC name is N-[2-(4-octyl-2-sulfanylphenoxy)ethyl]methanesulfonamide.
| Compound Name | N-[2-(4-octyl-2-sulfanylphenoxy)ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 57217953 |
| Molecular Formula | C17H29NO3S2 |
| Molecular Weight | 359.56 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | N-[2-(4-octyl-2-sulfanylphenoxy)ethyl]methanesulfonamide |
| SMILES | CCCCCCCCc1ccc(OCCNS(C)(=O)=O)c(S)c1 |
| InChI | InChI=1S/C17H29NO3S2/c1-3-4-5-6-7-8-9-15-10-11-16(17(22)14-15)21-13-12-18-23(2,19)20/h10-11,14,18,22H,3-9,12-13H2,1-2H3 |
| InChIKey | QWHYWMUNFDKDDF-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.56 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|