C28H42N6S — CID 169185508
4-[C-[[4-(aminomethyl)phenyl]methyl]-N-butylcarbonimidoyl]-7-[3-(methylsulfanylamino)propyl]quinoline-2,3-diamine;ethane (PubChem CID 169185508) has the molecular formula C28H42N6S and a molecular weight of 494.75 g/mol. Its IUPAC name is 4-[C-[[4-(aminomethyl)phenyl]methyl]-N-butylcarbonimidoyl]-7-[3-(methylsulfanylamino)propyl]quinoline-2,3-diamine;ethane.
| Compound Name | 4-[C-[[4-(aminomethyl)phenyl]methyl]-N-butylcarbonimidoyl]-7-[3-(methylsulfanylamino)propyl]quinoline-2,3-diamine;ethane |
|---|---|
| PubChem CID | 169185508 |
| Molecular Formula | C28H42N6S |
| Molecular Weight | 494.75 g/mol |
| Exact Mass | 494.32 |
| IUPAC Name | 4-[C-[[4-(aminomethyl)phenyl]methyl]-N-butylcarbonimidoyl]-7-[3-(methylsulfanylamino)propyl]quinoline-2,3-diamine;ethane |
| SMILES | CC.CCCC/N=C(\Cc1ccc(CN)cc1)c1c(N)c(N)nc2cc(CCCNSC)ccc12 |
| InChI | InChI=1S/C26H36N6S.C2H6/c1-3-4-13-30-23(16-19-7-9-20(17-27)10-8-19)24-21-12-11-18(6-5-14-31-33-2)15-22(21)32-26(29)25(24)28;1-2/h7-12,15,31H,3-6,13-14,16-17,27-28H2,1-2H3,(H2,29,32);1-2H3/b30-23+; |
| InChIKey | XHVKJDKDELRCNP-LMRTZVMQSA-N |
| XLogP | 5.52 |
| TPSA | 115.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.75 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|