C18H27N5O2S — CID 143197845
3-(2-ethoxyethylideneamino)-4-N-methyl-7-[3-(methylsulfanylamino)propoxy]quinoline-2,4-diamine (PubChem CID 143197845) has the molecular formula C18H27N5O2S and a molecular weight of 377.51 g/mol. Its IUPAC name is 3-(2-ethoxyethylideneamino)-4-N-methyl-7-[3-(methylsulfanylamino)propoxy]quinoline-2,4-diamine.
| Compound Name | 3-(2-ethoxyethylideneamino)-4-N-methyl-7-[3-(methylsulfanylamino)propoxy]quinoline-2,4-diamine |
|---|---|
| PubChem CID | 143197845 |
| Molecular Formula | C18H27N5O2S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 3-(2-ethoxyethylideneamino)-4-N-methyl-7-[3-(methylsulfanylamino)propoxy]quinoline-2,4-diamine |
| SMILES | CCOC/C=N/c1c(N)nc2cc(OCCCNSC)ccc2c1NC |
| InChI | InChI=1S/C18H27N5O2S/c1-4-24-11-9-21-17-16(20-2)14-7-6-13(12-15(14)23-18(17)19)25-10-5-8-22-26-3/h6-7,9,12,22H,4-5,8,10-11H2,1-3H3,(H3,19,20,23)/b21-9+ |
| InChIKey | GOKAUNBQSUOFCT-ZVBGSRNCSA-N |
| XLogP | 3.23 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|