C24H31N5O3S — CID 142145801
N-[2-[2-[[2-amino-3-(pentylideneamino)quinolin-4-yl]amino]ethoxy]ethyl]benzenesulfonamide (PubChem CID 142145801) has the molecular formula C24H31N5O3S and a molecular weight of 469.61 g/mol. Its IUPAC name is N-[2-[2-[[2-amino-3-(pentylideneamino)quinolin-4-yl]amino]ethoxy]ethyl]benzenesulfonamide.
| Compound Name | N-[2-[2-[[2-amino-3-(pentylideneamino)quinolin-4-yl]amino]ethoxy]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 142145801 |
| Molecular Formula | C24H31N5O3S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | N-[2-[2-[[2-amino-3-(pentylideneamino)quinolin-4-yl]amino]ethoxy]ethyl]benzenesulfonamide |
| SMILES | CCCC/C=N/c1c(N)nc2ccccc2c1NCCOCCNS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H31N5O3S/c1-2-3-9-14-26-23-22(20-12-7-8-13-21(20)29-24(23)25)27-15-17-32-18-16-28-33(30,31)19-10-5-4-6-11-19/h4-8,10-14,28H,2-3,9,15-18H2,1H3,(H3,25,27,29)/b26-14+ |
| InChIKey | VWNBOVJXAONUCQ-VULFUBBASA-N |
| XLogP | 4.12 |
| TPSA | 118.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|