C24H23N5O3S — CID 20613684
N-[2-[2-(4-aminoimidazo[4,5-c]quinolin-1-yl)ethoxy]ethyl]naphthalene-2-sulfonamide (PubChem CID 20613684) has the molecular formula C24H23N5O3S and a molecular weight of 461.55 g/mol. Its IUPAC name is N-[2-[2-(4-aminoimidazo[4,5-c]quinolin-1-yl)ethoxy]ethyl]naphthalene-2-sulfonamide.
| Compound Name | N-[2-[2-(4-aminoimidazo[4,5-c]quinolin-1-yl)ethoxy]ethyl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 20613684 |
| Molecular Formula | C24H23N5O3S |
| Molecular Weight | 461.55 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | N-[2-[2-(4-aminoimidazo[4,5-c]quinolin-1-yl)ethoxy]ethyl]naphthalene-2-sulfonamide |
| SMILES | Nc1nc2ccccc2c2c1ncn2CCOCCNS(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C24H23N5O3S/c25-24-22-23(20-7-3-4-8-21(20)28-24)29(16-26-22)12-14-32-13-11-27-33(30,31)19-10-9-17-5-1-2-6-18(17)15-19/h1-10,15-16,27H,11-14H2,(H2,25,28) |
| InChIKey | KYKRTOQIZCBESS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.55 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|