C28H38F3N3O4S — CID 142145803
fluoroform;(6E)-7-methoxy-3-methylsulfonylocta-1,6-dien-4-yne;4-methyl-3-(4-propoxybutylideneamino)quinolin-2-amine (PubChem CID 142145803) has the molecular formula C28H38F3N3O4S and a molecular weight of 569.69 g/mol. Its IUPAC name is fluoroform;(6E)-7-methoxy-3-methylsulfonylocta-1,6-dien-4-yne;4-methyl-3-(4-propoxybutylideneamino)quinolin-2-amine.
| Compound Name | fluoroform;(6E)-7-methoxy-3-methylsulfonylocta-1,6-dien-4-yne;4-methyl-3-(4-propoxybutylideneamino)quinolin-2-amine |
|---|---|
| PubChem CID | 142145803 |
| Molecular Formula | C28H38F3N3O4S |
| Molecular Weight | 569.69 g/mol |
| Exact Mass | 569.25 |
| IUPAC Name | fluoroform;(6E)-7-methoxy-3-methylsulfonylocta-1,6-dien-4-yne;4-methyl-3-(4-propoxybutylideneamino)quinolin-2-amine |
| SMILES | C=CC(C#C/C=C(\C)OC)S(C)(=O)=O.CCCOCCC/C=N/c1c(N)nc2ccccc2c1C.FC(F)F |
| InChI | InChI=1S/C17H23N3O.C10H14O3S.CHF3/c1-3-11-21-12-7-6-10-19-16-13(2)14-8-4-5-9-15(14)20-17(16)18;1-5-10(14(4,11)12)8-6-7-9(2)13-3;2-1(3)4/h4-5,8-10H,3,6-7,11-12H2,1-2H3,(H2,18,20);5,7,10H,1H2,2-4H3;1H/b19-10+;9-7+; |
| InChIKey | IMTAPDTYVRBPLO-KFFGTMQJSA-N |
| XLogP | 6.35 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.69 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|