C21H28N4O3S — CID 143089135
1-[2-(3-prop-2-enylsulfonylpropoxy)ethyl]-2-propylimidazo[4,5-c]quinolin-4-amine (PubChem CID 143089135) has the molecular formula C21H28N4O3S and a molecular weight of 416.55 g/mol. Its IUPAC name is 1-[2-(3-prop-2-enylsulfonylpropoxy)ethyl]-2-propylimidazo[4,5-c]quinolin-4-amine.
| Compound Name | 1-[2-(3-prop-2-enylsulfonylpropoxy)ethyl]-2-propylimidazo[4,5-c]quinolin-4-amine |
|---|---|
| PubChem CID | 143089135 |
| Molecular Formula | C21H28N4O3S |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | 1-[2-(3-prop-2-enylsulfonylpropoxy)ethyl]-2-propylimidazo[4,5-c]quinolin-4-amine |
| SMILES | C=CCS(=O)(=O)CCCOCCn1c(CCC)nc2c(N)nc3ccccc3c21 |
| InChI | InChI=1S/C21H28N4O3S/c1-3-8-18-24-19-20(16-9-5-6-10-17(16)23-21(19)22)25(18)11-13-28-12-7-15-29(26,27)14-4-2/h4-6,9-10H,2-3,7-8,11-15H2,1H3,(H2,22,23) |
| InChIKey | KJBSFIUTIWHJCP-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|