C22H26N4O — CID 142145757
2-butyl-1-(2-hex-5-en-2-ynoxyethyl)imidazo[4,5-c]quinolin-4-amine (PubChem CID 142145757) has the molecular formula C22H26N4O and a molecular weight of 362.48 g/mol. Its IUPAC name is 2-butyl-1-(2-hex-5-en-2-ynoxyethyl)imidazo[4,5-c]quinolin-4-amine.
| Compound Name | 2-butyl-1-(2-hex-5-en-2-ynoxyethyl)imidazo[4,5-c]quinolin-4-amine |
|---|---|
| PubChem CID | 142145757 |
| Molecular Formula | C22H26N4O |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 2-butyl-1-(2-hex-5-en-2-ynoxyethyl)imidazo[4,5-c]quinolin-4-amine |
| SMILES | C=CCC#CCOCCn1c(CCCC)nc2c(N)nc3ccccc3c21 |
| InChI | InChI=1S/C22H26N4O/c1-3-5-7-10-15-27-16-14-26-19(13-6-4-2)25-20-21(26)17-11-8-9-12-18(17)24-22(20)23/h3,8-9,11-12H,1,4-6,13-16H2,2H3,(H2,23,24) |
| InChIKey | NXYKJPCJERWXPY-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|