C19H25N5O — CID 87867716
2-butyl-1-[(4Z)-4-methoxyiminobutyl]imidazo[4,5-c]quinolin-4-amine (PubChem CID 87867716) has the molecular formula C19H25N5O and a molecular weight of 339.44 g/mol. Its IUPAC name is 2-butyl-1-[(4Z)-4-methoxyiminobutyl]imidazo[4,5-c]quinolin-4-amine.
| Compound Name | 2-butyl-1-[(4Z)-4-methoxyiminobutyl]imidazo[4,5-c]quinolin-4-amine |
|---|---|
| PubChem CID | 87867716 |
| Molecular Formula | C19H25N5O |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.21 |
| IUPAC Name | 2-butyl-1-[(4Z)-4-methoxyiminobutyl]imidazo[4,5-c]quinolin-4-amine |
| SMILES | CCCCc1nc2c(N)nc3ccccc3c2n1CCC/C=N\OC |
| InChI | InChI=1S/C19H25N5O/c1-3-4-11-16-23-17-18(24(16)13-8-7-12-21-25-2)14-9-5-6-10-15(14)22-19(17)20/h5-6,9-10,12H,3-4,7-8,11,13H2,1-2H3,(H2,20,22)/b21-12- |
| InChIKey | CEIBMZLVMAICQQ-MTJSOVHGSA-N |
| XLogP | 3.92 |
| TPSA | 78.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|