C20H27N5O — CID 90787884
2-butyl-1-[4-(methoxyamino)pent-3-enyl]imidazo[4,5-c]quinolin-4-amine (PubChem CID 90787884) has the molecular formula C20H27N5O and a molecular weight of 353.47 g/mol. Its IUPAC name is 2-butyl-1-[4-(methoxyamino)pent-3-enyl]imidazo[4,5-c]quinolin-4-amine.
| Compound Name | 2-butyl-1-[4-(methoxyamino)pent-3-enyl]imidazo[4,5-c]quinolin-4-amine |
|---|---|
| PubChem CID | 90787884 |
| Molecular Formula | C20H27N5O |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | 2-butyl-1-[4-(methoxyamino)pent-3-enyl]imidazo[4,5-c]quinolin-4-amine |
| SMILES | CCCCc1nc2c(N)nc3ccccc3c2n1CCC=C(C)NOC |
| InChI | InChI=1S/C20H27N5O/c1-4-5-12-17-23-18-19(25(17)13-8-9-14(2)24-26-3)15-10-6-7-11-16(15)22-20(18)21/h6-7,9-11,24H,4-5,8,12-13H2,1-3H3,(H2,21,22) |
| InChIKey | FIAYVLFQCROJAK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|