C24H36N4 — CID 158027544
7-(7,7-dimethyloctyl)-2-(ethylaminomethyl)-1H-pyrrolo[3,2-c]quinolin-4-amine (PubChem CID 158027544) has the molecular formula C24H36N4 and a molecular weight of 380.58 g/mol. Its IUPAC name is 7-(7,7-dimethyloctyl)-2-(ethylaminomethyl)-1H-pyrrolo[3,2-c]quinolin-4-amine.
| Compound Name | 7-(7,7-dimethyloctyl)-2-(ethylaminomethyl)-1H-pyrrolo[3,2-c]quinolin-4-amine |
|---|---|
| PubChem CID | 158027544 |
| Molecular Formula | C24H36N4 |
| Molecular Weight | 380.58 g/mol |
| Exact Mass | 380.29 |
| IUPAC Name | 7-(7,7-dimethyloctyl)-2-(ethylaminomethyl)-1H-pyrrolo[3,2-c]quinolin-4-amine |
| SMILES | CCNCc1cc2c(N)nc3cc(CCCCCCC(C)(C)C)ccc3c2[nH]1 |
| InChI | InChI=1S/C24H36N4/c1-5-26-16-18-15-20-22(27-18)19-12-11-17(14-21(19)28-23(20)25)10-8-6-7-9-13-24(2,3)4/h11-12,14-15,26-27H,5-10,13,16H2,1-4H3,(H2,25,28) |
| InChIKey | FGTXWOTUCPNRDO-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.58 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|