C27H46N6O2 — CID 167058389
4-[3-[5-[2,4-diamino-3-(methylamino)quinolin-7-yl]pentyl-methylamino]-2,2-dimethylpropoxy]-3,3-dimethylbutanamide (PubChem CID 167058389) has the molecular formula C27H46N6O2 and a molecular weight of 486.71 g/mol. Its IUPAC name is 4-[3-[5-[2,4-diamino-3-(methylamino)quinolin-7-yl]pentyl-methylamino]-2,2-dimethylpropoxy]-3,3-dimethylbutanamide.
| Compound Name | 4-[3-[5-[2,4-diamino-3-(methylamino)quinolin-7-yl]pentyl-methylamino]-2,2-dimethylpropoxy]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 167058389 |
| Molecular Formula | C27H46N6O2 |
| Molecular Weight | 486.71 g/mol |
| Exact Mass | 486.37 |
| IUPAC Name | 4-[3-[5-[2,4-diamino-3-(methylamino)quinolin-7-yl]pentyl-methylamino]-2,2-dimethylpropoxy]-3,3-dimethylbutanamide |
| SMILES | CNc1c(N)nc2cc(CCCCCN(C)CC(C)(C)COCC(C)(C)CC(N)=O)ccc2c1N |
| InChI | InChI=1S/C27H46N6O2/c1-26(2,15-22(28)34)17-35-18-27(3,4)16-33(6)13-9-7-8-10-19-11-12-20-21(14-19)32-25(30)24(31-5)23(20)29/h11-12,14,31H,7-10,13,15-18H2,1-6H3,(H2,28,34)(H4,29,30,32) |
| InChIKey | OFUQNLSWJHXGPV-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 132.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.71 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|