C24H34N2O — CID 159487559
7-(7,7-dimethyloctyl)-2-propylfuro[3,2-c]quinolin-4-amine (PubChem CID 159487559) has the molecular formula C24H34N2O and a molecular weight of 366.55 g/mol. Its IUPAC name is 7-(7,7-dimethyloctyl)-2-propylfuro[3,2-c]quinolin-4-amine.
| Compound Name | 7-(7,7-dimethyloctyl)-2-propylfuro[3,2-c]quinolin-4-amine |
|---|---|
| PubChem CID | 159487559 |
| Molecular Formula | C24H34N2O |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.27 |
| IUPAC Name | 7-(7,7-dimethyloctyl)-2-propylfuro[3,2-c]quinolin-4-amine |
| SMILES | CCCc1cc2c(N)nc3cc(CCCCCCC(C)(C)C)ccc3c2o1 |
| InChI | InChI=1S/C24H34N2O/c1-5-10-18-16-20-22(27-18)19-13-12-17(15-21(19)26-23(20)25)11-8-6-7-9-14-24(2,3)4/h12-13,15-16H,5-11,14H2,1-4H3,(H2,25,26) |
| InChIKey | LXTQFDYXUDFDDV-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|