C25H41N5S — CID 155696729
3-[5-(4-amino-2-butyl-2,3-dihydro-1H-imidazo[4,5-c]quinolin-7-yl)pentyl-methylamino]-2,2-dimethylpropane-1-thiol (PubChem CID 155696729) has the molecular formula C25H41N5S and a molecular weight of 443.71 g/mol. Its IUPAC name is 3-[5-(4-amino-2-butyl-2,3-dihydro-1H-imidazo[4,5-c]quinolin-7-yl)pentyl-methylamino]-2,2-dimethylpropane-1-thiol.
| Compound Name | 3-[5-(4-amino-2-butyl-2,3-dihydro-1H-imidazo[4,5-c]quinolin-7-yl)pentyl-methylamino]-2,2-dimethylpropane-1-thiol |
|---|---|
| PubChem CID | 155696729 |
| Molecular Formula | C25H41N5S |
| Molecular Weight | 443.71 g/mol |
| Exact Mass | 443.31 |
| IUPAC Name | 3-[5-(4-amino-2-butyl-2,3-dihydro-1H-imidazo[4,5-c]quinolin-7-yl)pentyl-methylamino]-2,2-dimethylpropane-1-thiol |
| SMILES | CCCCC1Nc2c(N)nc3cc(CCCCCN(C)CC(C)(C)CS)ccc3c2N1 |
| InChI | InChI=1S/C25H41N5S/c1-5-6-11-21-28-22-19-13-12-18(15-20(19)27-24(26)23(22)29-21)10-8-7-9-14-30(4)16-25(2,3)17-31/h12-13,15,21,28-29,31H,5-11,14,16-17H2,1-4H3,(H2,26,27) |
| InChIKey | MDRGPTKMUAARKA-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 66.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.71 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|