C16H19N3O5S — CID 177083389
(2R)-2-amino-3-[[(2S)-2-(naphthalen-1-ylamino)propanoyl]amino]-3-oxopropane-1-sulfonic acid (PubChem CID 177083389) has the molecular formula C16H19N3O5S and a molecular weight of 365.41 g/mol. Its IUPAC name is (2R)-2-amino-3-[[(2S)-2-(naphthalen-1-ylamino)propanoyl]amino]-3-oxopropane-1-sulfonic acid.
| Compound Name | (2R)-2-amino-3-[[(2S)-2-(naphthalen-1-ylamino)propanoyl]amino]-3-oxopropane-1-sulfonic acid |
|---|---|
| PubChem CID | 177083389 |
| Molecular Formula | C16H19N3O5S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | (2R)-2-amino-3-[[(2S)-2-(naphthalen-1-ylamino)propanoyl]amino]-3-oxopropane-1-sulfonic acid |
| SMILES | C[C@H](Nc1cccc2ccccc12)C(=O)NC(=O)[C@@H](N)CS(=O)(=O)O |
| InChI | InChI=1S/C16H19N3O5S/c1-10(15(20)19-16(21)13(17)9-25(22,23)24)18-14-8-4-6-11-5-2-3-7-12(11)14/h2-8,10,13,18H,9,17H2,1H3,(H,19,20,21)(H,22,23,24)/t10-,13-/m0/s1 |
| InChIKey | NUUDZDKIPJKEKS-GWCFXTLKSA-N |
| XLogP | 0.50 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|