C47H41N3Si — CID 177088340
trimethyl-[4-[4-phenyl-6-[3-(3-spiro[cyclopentane-1,9'-fluorene]-2'-ylphenyl)phenyl]-1,3,5-triazin-2-yl]phenyl]silane (PubChem CID 177088340) has the molecular formula C47H41N3Si and a molecular weight of 675.95 g/mol. Its IUPAC name is trimethyl-[4-[4-phenyl-6-[3-(3-spiro[cyclopentane-1,9'-fluorene]-2'-ylphenyl)phenyl]-1,3,5-triazin-2-yl]phenyl]silane.
| Compound Name | trimethyl-[4-[4-phenyl-6-[3-(3-spiro[cyclopentane-1,9'-fluorene]-2'-ylphenyl)phenyl]-1,3,5-triazin-2-yl]phenyl]silane |
|---|---|
| PubChem CID | 177088340 |
| Molecular Formula | C47H41N3Si |
| Molecular Weight | 675.95 g/mol |
| Exact Mass | 675.31 |
| IUPAC Name | trimethyl-[4-[4-phenyl-6-[3-(3-spiro[cyclopentane-1,9'-fluorene]-2'-ylphenyl)phenyl]-1,3,5-triazin-2-yl]phenyl]silane |
| SMILES | C[Si](C)(C)c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc(-c4cccc(-c5ccc6c(c5)C5(CCCC5)c5ccccc5-6)c4)c3)n2)cc1 |
| InChI | InChI=1S/C47H41N3Si/c1-51(2,3)39-24-21-33(22-25-39)45-48-44(32-13-5-4-6-14-32)49-46(50-45)38-18-12-17-36(30-38)34-15-11-16-35(29-34)37-23-26-41-40-19-7-8-20-42(40)47(43(41)31-37)27-9-10-28-47/h4-8,11-26,29-31H,9-10,27-28H2,1-3H3 |
| InChIKey | GJFUFJNDHCISRL-UHFFFAOYSA-N |
| XLogP | 11.59 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.95 |
| LogP ≤ 5 | 11.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|