C64H57N4OPt- — CID 177093904
2-[4-[3-tert-butyl-5-[4-(9-naphthalen-2-ylcarbazol-3-yl)-2-pyridinyl]benzene-6-id-1-yl]-1-(3,5-ditert-butylphenyl)benzimidazol-2-yl]phenol;platinum (PubChem CID 177093904) has the molecular formula C64H57N4OPt- and a molecular weight of 1093.26 g/mol. Its IUPAC name is 2-[4-[3-tert-butyl-5-[4-(9-naphthalen-2-ylcarbazol-3-yl)-2-pyridinyl]benzene-6-id-1-yl]-1-(3,5-ditert-butylphenyl)benzimidazol-2-yl]phenol;platinum.
| Compound Name | 2-[4-[3-tert-butyl-5-[4-(9-naphthalen-2-ylcarbazol-3-yl)-2-pyridinyl]benzene-6-id-1-yl]-1-(3,5-ditert-butylphenyl)benzimidazol-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 177093904 |
| Molecular Formula | C64H57N4OPt- |
| Molecular Weight | 1093.26 g/mol |
| Exact Mass | 1092.42 |
| IUPAC Name | 2-[4-[3-tert-butyl-5-[4-(9-naphthalen-2-ylcarbazol-3-yl)-2-pyridinyl]benzene-6-id-1-yl]-1-(3,5-ditert-butylphenyl)benzimidazol-2-yl]phenol;platinum |
| SMILES | CC(C)(C)c1cc(-c2cc(-c3ccc4c(c3)c3ccccc3n4-c3ccc4ccccc4c3)ccn2)[c-]c(-c2cccc3c2nc(-c2ccccc2O)n3-c2cc(C(C)(C)C)cc(C(C)(C)C)c2)c1.[Pt] |
| InChI | InChI=1S/C64H57N4O.Pt/c1-62(2,3)46-32-44(51-21-16-23-58-60(51)66-61(53-20-13-15-24-59(53)69)68(58)50-38-47(63(4,5)6)37-48(39-50)64(7,8)9)31-45(33-46)55-36-43(29-30-65-55)42-26-28-57-54(35-42)52-19-12-14-22-56(52)67(57)49-27-25-40-17-10-11-18-41(40)34-49;/h10-30,32-39,69H,1-9H3;/q-1; |
| InChIKey | ZWHODFFGQHCZRL-UHFFFAOYSA-N |
| XLogP | 16.73 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1093.26 |
| LogP ≤ 5 | 16.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|