C29H41N3O3 — CID 177096386
benzyl N-[4-[4-[4-[3-(2-aminoethylamino)-3-oxopropyl]cyclohexyl]phenyl]butyl]carbamate (PubChem CID 177096386) has the molecular formula C29H41N3O3 and a molecular weight of 479.67 g/mol. Its IUPAC name is benzyl N-[4-[4-[4-[3-(2-aminoethylamino)-3-oxopropyl]cyclohexyl]phenyl]butyl]carbamate.
| Compound Name | benzyl N-[4-[4-[4-[3-(2-aminoethylamino)-3-oxopropyl]cyclohexyl]phenyl]butyl]carbamate |
|---|---|
| PubChem CID | 177096386 |
| Molecular Formula | C29H41N3O3 |
| Molecular Weight | 479.67 g/mol |
| Exact Mass | 479.31 |
| IUPAC Name | benzyl N-[4-[4-[4-[3-(2-aminoethylamino)-3-oxopropyl]cyclohexyl]phenyl]butyl]carbamate |
| SMILES | NCCNC(=O)CCC1CCC(c2ccc(CCCCNC(=O)OCc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C29H41N3O3/c30-19-21-31-28(33)18-13-24-11-16-27(17-12-24)26-14-9-23(10-15-26)6-4-5-20-32-29(34)35-22-25-7-2-1-3-8-25/h1-3,7-10,14-15,24,27H,4-6,11-13,16-22,30H2,(H,31,33)(H,32,34) |
| InChIKey | ITERNTOHGGTKBO-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.67 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|