C16H27ClN2O4 — CID 177099642
3-[5-[(4-chlorocyclohexyl)oxymethyl]-1,2,4-oxadiazolidin-3-yl]cyclohexane-1-carboxylic acid (PubChem CID 177099642) has the molecular formula C16H27ClN2O4 and a molecular weight of 346.86 g/mol. Its IUPAC name is 3-[5-[(4-chlorocyclohexyl)oxymethyl]-1,2,4-oxadiazolidin-3-yl]cyclohexane-1-carboxylic acid.
| Compound Name | 3-[5-[(4-chlorocyclohexyl)oxymethyl]-1,2,4-oxadiazolidin-3-yl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 177099642 |
| Molecular Formula | C16H27ClN2O4 |
| Molecular Weight | 346.86 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 3-[5-[(4-chlorocyclohexyl)oxymethyl]-1,2,4-oxadiazolidin-3-yl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCCC(C2NOC(COC3CCC(Cl)CC3)N2)C1 |
| InChI | InChI=1S/C16H27ClN2O4/c17-12-4-6-13(7-5-12)22-9-14-18-15(19-23-14)10-2-1-3-11(8-10)16(20)21/h10-15,18-19H,1-9H2,(H,20,21) |
| InChIKey | KYJBKYARBMBICD-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.86 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|