C20H36N2O4 — CID 177099708
3-[5-(4-pentoxycyclohexyl)-1,2,4-oxadiazolidin-3-yl]cyclohexane-1-carboxylic acid (PubChem CID 177099708) has the molecular formula C20H36N2O4 and a molecular weight of 368.52 g/mol. Its IUPAC name is 3-[5-(4-pentoxycyclohexyl)-1,2,4-oxadiazolidin-3-yl]cyclohexane-1-carboxylic acid.
| Compound Name | 3-[5-(4-pentoxycyclohexyl)-1,2,4-oxadiazolidin-3-yl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 177099708 |
| Molecular Formula | C20H36N2O4 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | 3-[5-(4-pentoxycyclohexyl)-1,2,4-oxadiazolidin-3-yl]cyclohexane-1-carboxylic acid |
| SMILES | CCCCCOC1CCC(C2NC(C3CCCC(C(=O)O)C3)NO2)CC1 |
| InChI | InChI=1S/C20H36N2O4/c1-2-3-4-12-25-17-10-8-14(9-11-17)19-21-18(22-26-19)15-6-5-7-16(13-15)20(23)24/h14-19,21-22H,2-13H2,1H3,(H,23,24) |
| InChIKey | YAGMYGCYYMOYSG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|