C18H24O8 — CID 177101859
3-[2-(2-carboxyethoxymethyl)-2-methyl-3-oxo-3-phenylmethoxypropoxy]propanoic acid (PubChem CID 177101859) has the molecular formula C18H24O8 and a molecular weight of 368.38 g/mol. Its IUPAC name is 3-[2-(2-carboxyethoxymethyl)-2-methyl-3-oxo-3-phenylmethoxypropoxy]propanoic acid.
| Compound Name | 3-[2-(2-carboxyethoxymethyl)-2-methyl-3-oxo-3-phenylmethoxypropoxy]propanoic acid |
|---|---|
| PubChem CID | 177101859 |
| Molecular Formula | C18H24O8 |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 3-[2-(2-carboxyethoxymethyl)-2-methyl-3-oxo-3-phenylmethoxypropoxy]propanoic acid |
| SMILES | CC(COCCC(=O)O)(COCCC(=O)O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H24O8/c1-18(12-24-9-7-15(19)20,13-25-10-8-16(21)22)17(23)26-11-14-5-3-2-4-6-14/h2-6H,7-13H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | QNNPIZBPAKNOBM-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|