C23H35NO6 — CID 166907155
benzyl 3-[2-[2-(4,4-dimethyl-3-oxopentoxy)ethoxy]ethylamino]-2,2-dimethyl-3-oxopropanoate (PubChem CID 166907155) has the molecular formula C23H35NO6 and a molecular weight of 421.53 g/mol. Its IUPAC name is benzyl 3-[2-[2-(4,4-dimethyl-3-oxopentoxy)ethoxy]ethylamino]-2,2-dimethyl-3-oxopropanoate.
| Compound Name | benzyl 3-[2-[2-(4,4-dimethyl-3-oxopentoxy)ethoxy]ethylamino]-2,2-dimethyl-3-oxopropanoate |
|---|---|
| PubChem CID | 166907155 |
| Molecular Formula | C23H35NO6 |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | benzyl 3-[2-[2-(4,4-dimethyl-3-oxopentoxy)ethoxy]ethylamino]-2,2-dimethyl-3-oxopropanoate |
| SMILES | CC(C)(C)C(=O)CCOCCOCCNC(=O)C(C)(C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H35NO6/c1-22(2,3)19(25)11-13-28-15-16-29-14-12-24-20(26)23(4,5)21(27)30-17-18-9-7-6-8-10-18/h6-10H,11-17H2,1-5H3,(H,24,26) |
| InChIKey | CIJJYHIPAANPBG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|