About 3-acetyl-4-oxo-N,N-bis(prop-2-ynyl)pentanamide
3-acetyl-4-oxo-N,N-bis(prop-2-ynyl)pentanamide (PubChem CID 177102655) has the molecular formula C13H15NO3
and a molecular weight of 233.27 g/mol. Its IUPAC name is 3-acetyl-4-oxo-N,N-bis(prop-2-ynyl)pentanamide.
Molecular Properties
| Compound Name | 3-acetyl-4-oxo-N,N-bis(prop-2-ynyl)pentanamide |
| PubChem CID | 177102655 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 3-acetyl-4-oxo-N,N-bis(prop-2-ynyl)pentanamide |
| SMILES | C#CCN(CC#C)C(=O)CC(C(C)=O)C(C)=O |
| InChI | InChI=1S/C13H15NO3/c1-5-7-14(8-6-2)13(17)9-12(10(3)15)11(4)16/h1-2,12H,7-9H2,3-4H3 |
| InChIKey | XZDZCBXQPSYLBW-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-acetyl-4-oxo-N,N-bis(prop-2-ynyl)pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acetyl-4-oxo-N,N-bis(prop-2-ynyl)pentanamide?
The IUPAC name of 3-acetyl-4-oxo-N,N-bis(prop-2-ynyl)pentanamide (CID 177102655) is 3-acetyl-4-oxo-N,N-bis(prop-2-ynyl)pentanamide.
What is the SMILES notation for 3-acetyl-4-oxo-N,N-bis(prop-2-ynyl)pentanamide?
The canonical SMILES for 3-acetyl-4-oxo-N,N-bis(prop-2-ynyl)pentanamide is C#CCN(CC#C)C(=O)CC(C(C)=O)C(C)=O.
What is the InChIKey of 3-acetyl-4-oxo-N,N-bis(prop-2-ynyl)pentanamide?
The InChIKey is XZDZCBXQPSYLBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO3/c1-5-7-14(8-6-2)13(17)9-12(10(3)15)11(4)16/h1-2,12H,7-9H2,3-4H3.
What are the key properties of 3-acetyl-4-oxo-N,N-bis(prop-2-ynyl)pentanamide?
3-acetyl-4-oxo-N,N-bis(prop-2-ynyl)pentanamide has a molecular weight of 233.27 g/mol, XLogP of 0.27, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetyl-4-oxo-N,N-bis(prop-2-ynyl)pentanamide is sourced from PubChem (CID 177102655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).