C8H8ClNO — CID 55303695
2-chloro-N,N-bis(prop-2-ynyl)acetamide (PubChem CID 55303695) has the molecular formula C8H8ClNO and a molecular weight of 169.61 g/mol. Its IUPAC name is 2-chloro-N,N-bis(prop-2-ynyl)acetamide.
| Compound Name | 2-chloro-N,N-bis(prop-2-ynyl)acetamide |
|---|---|
| PubChem CID | 55303695 |
| Molecular Formula | C8H8ClNO |
| Molecular Weight | 169.61 g/mol |
| Exact Mass | 169.03 |
| IUPAC Name | 2-chloro-N,N-bis(prop-2-ynyl)acetamide |
| SMILES | C#CCN(CC#C)C(=O)CCl |
| InChI | InChI=1S/C8H8ClNO/c1-3-5-10(6-4-2)8(11)7-9/h1-2H,5-7H2 |
| InChIKey | WVECKRTXZJBQIJ-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.61 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|