C83H96Br2N2 — CID 177103174
1-N,3-N-bis(3-bromophenyl)-1-N,3-N-bis[4-tert-butyl-2,6-bis(3-tert-butylphenyl)phenyl]-5-(2,2-dimethylpropyl)benzene-1,3-diamine (PubChem CID 177103174) has the molecular formula C83H96Br2N2 and a molecular weight of 1281.50 g/mol. Its IUPAC name is 1-N,3-N-bis(3-bromophenyl)-1-N,3-N-bis[4-tert-butyl-2,6-bis(3-tert-butylphenyl)phenyl]-5-(2,2-dimethylpropyl)benzene-1,3-diamine.
| Compound Name | 1-N,3-N-bis(3-bromophenyl)-1-N,3-N-bis[4-tert-butyl-2,6-bis(3-tert-butylphenyl)phenyl]-5-(2,2-dimethylpropyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 177103174 |
| Molecular Formula | C83H96Br2N2 |
| Molecular Weight | 1281.50 g/mol |
| Exact Mass | 1278.59 |
| IUPAC Name | 1-N,3-N-bis(3-bromophenyl)-1-N,3-N-bis[4-tert-butyl-2,6-bis(3-tert-butylphenyl)phenyl]-5-(2,2-dimethylpropyl)benzene-1,3-diamine |
| SMILES | CC(C)(C)Cc1cc(N(c2cccc(Br)c2)c2c(-c3cccc(C(C)(C)C)c3)cc(C(C)(C)C)cc2-c2cccc(C(C)(C)C)c2)cc(N(c2cccc(Br)c2)c2c(-c3cccc(C(C)(C)C)c3)cc(C(C)(C)C)cc2-c2cccc(C(C)(C)C)c2)c1 |
| InChI | InChI=1S/C83H96Br2N2/c1-77(2,3)53-54-40-69(86(67-38-26-36-65(84)50-67)75-71(55-28-22-32-59(42-55)78(4,5)6)46-63(82(16,17)18)47-72(75)56-29-23-33-60(43-56)79(7,8)9)52-70(41-54)87(68-39-27-37-66(85)51-68)76-73(57-30-24-34-61(44-57)80(10,11)12)48-64(83(19,20)21)49-74(76)58-31-25-35-62(45-58)81(13,14)15/h22-52H,53H2,1-21H3 |
| InChIKey | UPKZETMTYIFHEZ-UHFFFAOYSA-N |
| XLogP | 26.19 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 87 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1281.50 |
| LogP ≤ 5 | 26.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |