About CID 177106113
CID 177106113 (PubChem CID 177106113) has the molecular formula C17H31BO10P-
and a molecular weight of 437.21 g/mol.
Molecular Properties
| Compound Name | CID 177106113 |
| PubChem CID | 177106113 |
| Molecular Formula | C17H31BO10P- |
| Molecular Weight | 437.21 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1O[C@H](COP(=O)([O-])OC(C)C)[C@H](OC(C)C)C1OC(=O)CCOCCOC |
| InChI | InChI=1S/C17H32BO10P/c1-11(2)25-15-13(10-24-29(20,21)28-12(3)4)26-17(18)16(15)27-14(19)6-7-23-9-8-22-5/h11-13,15-17H,6-10H2,1-5H3,(H,20,21)/p-1/t13-,15+,16?,17-/m1/s1 |
| InChIKey | MZYZSZGMNNZZST-NMBWSBHNSA-M |
| XLogP | 0.55 |
| TPSA | 121.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.21 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 177106113 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177106113?
The IUPAC name of CID 177106113 (CID 177106113) is not available.
What is the SMILES notation for CID 177106113?
The canonical SMILES for CID 177106113 is [B][C@@H]1O[C@H](COP(=O)([O-])OC(C)C)[C@H](OC(C)C)C1OC(=O)CCOCCOC.
What is the InChIKey of CID 177106113?
The InChIKey is MZYZSZGMNNZZST-NMBWSBHNSA-M. The full InChI is InChI=1S/C17H32BO10P/c1-11(2)25-15-13(10-24-29(20,21)28-12(3)4)26-17(18)16(15)27-14(19)6-7-23-9-8-22-5/h11-13,15-17H,6-10H2,1-5H3,(H,20,21)/p-1/t13-,15+,16?,17-/m1/s1.
What are the key properties of CID 177106113?
CID 177106113 has a molecular weight of 437.21 g/mol, XLogP of 0.55, 14 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177106113 is sourced from PubChem (CID 177106113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).