C39H40N3O2Pt- — CID 177110994
4-tert-butyl-2-[6-tert-butyl-4-[3-(8-tert-butyl-1,5-naphthyridin-4-yl)benzene-2-id-1-yl]-1,3-benzoxazol-2-yl]phenol;platinum (PubChem CID 177110994) has the molecular formula C39H40N3O2Pt- and a molecular weight of 777.85 g/mol. Its IUPAC name is 4-tert-butyl-2-[6-tert-butyl-4-[3-(8-tert-butyl-1,5-naphthyridin-4-yl)benzene-2-id-1-yl]-1,3-benzoxazol-2-yl]phenol;platinum.
| Compound Name | 4-tert-butyl-2-[6-tert-butyl-4-[3-(8-tert-butyl-1,5-naphthyridin-4-yl)benzene-2-id-1-yl]-1,3-benzoxazol-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 177110994 |
| Molecular Formula | C39H40N3O2Pt- |
| Molecular Weight | 777.85 g/mol |
| Exact Mass | 777.28 |
| IUPAC Name | 4-tert-butyl-2-[6-tert-butyl-4-[3-(8-tert-butyl-1,5-naphthyridin-4-yl)benzene-2-id-1-yl]-1,3-benzoxazol-2-yl]phenol;platinum |
| SMILES | CC(C)(C)c1ccc(O)c(-c2nc3c(-c4[c-]c(-c5ccnc6c(C(C)(C)C)ccnc56)ccc4)cc(C(C)(C)C)cc3o2)c1.[Pt] |
| InChI | InChI=1S/C39H40N3O2.Pt/c1-37(2,3)25-13-14-31(43)29(20-25)36-42-33-28(21-26(38(4,5)6)22-32(33)44-36)24-12-10-11-23(19-24)27-15-17-41-35-30(39(7,8)9)16-18-40-34(27)35;/h10-18,20-22,43H,1-9H3;/q-1; |
| InChIKey | QPVJLTLXIVGZQF-UHFFFAOYSA-N |
| XLogP | 10.17 |
| TPSA | 72.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.85 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|