C31H33FO7S — CID 177111113
4-[4-fluoro-3-[2-methyl-1-(8-tricyclo[5.2.1.02,6]decanyloxy)propoxy]benzoyl]oxynaphthalene-1-sulfonic acid (PubChem CID 177111113) has the molecular formula C31H33FO7S and a molecular weight of 568.66 g/mol. Its IUPAC name is 4-[4-fluoro-3-[2-methyl-1-(8-tricyclo[5.2.1.02,6]decanyloxy)propoxy]benzoyl]oxynaphthalene-1-sulfonic acid.
| Compound Name | 4-[4-fluoro-3-[2-methyl-1-(8-tricyclo[5.2.1.02,6]decanyloxy)propoxy]benzoyl]oxynaphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 177111113 |
| Molecular Formula | C31H33FO7S |
| Molecular Weight | 568.66 g/mol |
| Exact Mass | 568.19 |
| IUPAC Name | 4-[4-fluoro-3-[2-methyl-1-(8-tricyclo[5.2.1.02,6]decanyloxy)propoxy]benzoyl]oxynaphthalene-1-sulfonic acid |
| SMILES | CC(C)C(Oc1cc(C(=O)Oc2ccc(S(=O)(=O)O)c3ccccc23)ccc1F)OC1CC2CC1C1CCCC21 |
| InChI | InChI=1S/C31H33FO7S/c1-17(2)31(38-27-16-19-14-24(27)21-9-5-8-20(19)21)39-28-15-18(10-11-25(28)32)30(33)37-26-12-13-29(40(34,35)36)23-7-4-3-6-22(23)26/h3-4,6-7,10-13,15,17,19-21,24,27,31H,5,8-9,14,16H2,1-2H3,(H,34,35,36) |
| InChIKey | VSHPJOCGVWCKNZ-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.66 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|