C13H13ClN2 — CID 177117108
3-chloro-5-ethenyl-N,N-dimethylisoquinolin-8-amine (PubChem CID 177117108) has the molecular formula C13H13ClN2 and a molecular weight of 232.71 g/mol. Its IUPAC name is 3-chloro-5-ethenyl-N,N-dimethylisoquinolin-8-amine.
| Compound Name | 3-chloro-5-ethenyl-N,N-dimethylisoquinolin-8-amine |
|---|---|
| PubChem CID | 177117108 |
| Molecular Formula | C13H13ClN2 |
| Molecular Weight | 232.71 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 3-chloro-5-ethenyl-N,N-dimethylisoquinolin-8-amine |
| SMILES | C=Cc1ccc(N(C)C)c2cnc(Cl)cc12 |
| InChI | InChI=1S/C13H13ClN2/c1-4-9-5-6-12(16(2)3)11-8-15-13(14)7-10(9)11/h4-8H,1H2,2-3H3 |
| InChIKey | CGCNOVHKPASVOE-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.71 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|