C22H24ClN5O — CID 177118014
5-chloro-2-[(2-methoxy-4-piperazin-1-ylphenyl)methyl]-N-phenylpyrimidin-4-amine (PubChem CID 177118014) has the molecular formula C22H24ClN5O and a molecular weight of 409.92 g/mol. Its IUPAC name is 5-chloro-2-[(2-methoxy-4-piperazin-1-ylphenyl)methyl]-N-phenylpyrimidin-4-amine.
| Compound Name | 5-chloro-2-[(2-methoxy-4-piperazin-1-ylphenyl)methyl]-N-phenylpyrimidin-4-amine |
|---|---|
| PubChem CID | 177118014 |
| Molecular Formula | C22H24ClN5O |
| Molecular Weight | 409.92 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | 5-chloro-2-[(2-methoxy-4-piperazin-1-ylphenyl)methyl]-N-phenylpyrimidin-4-amine |
| SMILES | COc1cc(N2CCNCC2)ccc1Cc1ncc(Cl)c(Nc2ccccc2)n1 |
| InChI | InChI=1S/C22H24ClN5O/c1-29-20-14-18(28-11-9-24-10-12-28)8-7-16(20)13-21-25-15-19(23)22(27-21)26-17-5-3-2-4-6-17/h2-8,14-15,24H,9-13H2,1H3,(H,25,26,27) |
| InChIKey | ZXJXUQGPRCABMK-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.92 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |