C17H27ClNO5P — CID 177122504
ditert-butyl [4-[[carbonochloridoyl(methyl)amino]methyl]phenyl] phosphate (PubChem CID 177122504) has the molecular formula C17H27ClNO5P and a molecular weight of 391.83 g/mol. Its IUPAC name is ditert-butyl [4-[[carbonochloridoyl(methyl)amino]methyl]phenyl] phosphate.
| Compound Name | ditert-butyl [4-[[carbonochloridoyl(methyl)amino]methyl]phenyl] phosphate |
|---|---|
| PubChem CID | 177122504 |
| Molecular Formula | C17H27ClNO5P |
| Molecular Weight | 391.83 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | ditert-butyl [4-[[carbonochloridoyl(methyl)amino]methyl]phenyl] phosphate |
| SMILES | CN(Cc1ccc(OP(=O)(OC(C)(C)C)OC(C)(C)C)cc1)C(=O)Cl |
| InChI | InChI=1S/C17H27ClNO5P/c1-16(2,3)23-25(21,24-17(4,5)6)22-14-10-8-13(9-11-14)12-19(7)15(18)20/h8-11H,12H2,1-7H3 |
| InChIKey | YULWNFHIXKVYEO-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.83 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|