C22H35ClNO7P — CID 177122527
tert-butyl 4-[bis[(2-methylpropan-2-yl)oxy]phosphoryloxy]-3-[[carbonochloridoyl(methyl)amino]methyl]benzoate (PubChem CID 177122527) has the molecular formula C22H35ClNO7P and a molecular weight of 491.95 g/mol. Its IUPAC name is tert-butyl 4-[bis[(2-methylpropan-2-yl)oxy]phosphoryloxy]-3-[[carbonochloridoyl(methyl)amino]methyl]benzoate.
| Compound Name | tert-butyl 4-[bis[(2-methylpropan-2-yl)oxy]phosphoryloxy]-3-[[carbonochloridoyl(methyl)amino]methyl]benzoate |
|---|---|
| PubChem CID | 177122527 |
| Molecular Formula | C22H35ClNO7P |
| Molecular Weight | 491.95 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | tert-butyl 4-[bis[(2-methylpropan-2-yl)oxy]phosphoryloxy]-3-[[carbonochloridoyl(methyl)amino]methyl]benzoate |
| SMILES | CN(Cc1cc(C(=O)OC(C)(C)C)ccc1OP(=O)(OC(C)(C)C)OC(C)(C)C)C(=O)Cl |
| InChI | InChI=1S/C22H35ClNO7P/c1-20(2,3)28-18(25)15-11-12-17(16(13-15)14-24(10)19(23)26)29-32(27,30-21(4,5)6)31-22(7,8)9/h11-13H,14H2,1-10H3 |
| InChIKey | UBORAWOSWXURAJ-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.95 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|