C20H33O7P — CID 177122523
tert-butyl 4-[bis[(2-methylpropan-2-yl)oxy]phosphoryloxy]-3-methoxybenzoate (PubChem CID 177122523) has the molecular formula C20H33O7P and a molecular weight of 416.45 g/mol. Its IUPAC name is tert-butyl 4-[bis[(2-methylpropan-2-yl)oxy]phosphoryloxy]-3-methoxybenzoate.
| Compound Name | tert-butyl 4-[bis[(2-methylpropan-2-yl)oxy]phosphoryloxy]-3-methoxybenzoate |
|---|---|
| PubChem CID | 177122523 |
| Molecular Formula | C20H33O7P |
| Molecular Weight | 416.45 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | tert-butyl 4-[bis[(2-methylpropan-2-yl)oxy]phosphoryloxy]-3-methoxybenzoate |
| SMILES | COc1cc(C(=O)OC(C)(C)C)ccc1OP(=O)(OC(C)(C)C)OC(C)(C)C |
| InChI | InChI=1S/C20H33O7P/c1-18(2,3)24-17(21)14-11-12-15(16(13-14)23-10)25-28(22,26-19(4,5)6)27-20(7,8)9/h11-13H,1-10H3 |
| InChIKey | JAFSORCCTCDLEO-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.45 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|