About N-tert-butyl-3-[[5-(2,2-dimethylpropoxy)-2-pyridinyl]methyl]cyclobutan-1-amine
N-tert-butyl-3-[[5-(2,2-dimethylpropoxy)-2-pyridinyl]methyl]cyclobutan-1-amine (PubChem CID 177124053) has the molecular formula C19H32N2O
and a molecular weight of 304.48 g/mol. Its IUPAC name is N-tert-butyl-3-[[5-(2,2-dimethylpropoxy)-2-pyridinyl]methyl]cyclobutan-1-amine.
Molecular Properties
| Compound Name | N-tert-butyl-3-[[5-(2,2-dimethylpropoxy)-2-pyridinyl]methyl]cyclobutan-1-amine |
| PubChem CID | 177124053 |
| Molecular Formula | C19H32N2O |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.25 |
| IUPAC Name | N-tert-butyl-3-[[5-(2,2-dimethylpropoxy)-2-pyridinyl]methyl]cyclobutan-1-amine |
| SMILES | CC(C)(C)COc1ccc(CC2CC(NC(C)(C)C)C2)nc1 |
| InChI | InChI=1S/C19H32N2O/c1-18(2,3)13-22-17-8-7-15(20-12-17)9-14-10-16(11-14)21-19(4,5)6/h7-8,12,14,16,21H,9-11,13H2,1-6H3 |
| InChIKey | XBOMPZMSDLVMGW-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-tert-butyl-3-[[5-(2,2-dimethylpropoxy)-2-pyridinyl]methyl]cyclobutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-3-[[5-(2,2-dimethylpropoxy)-2-pyridinyl]methyl]cyclobutan-1-amine?
The IUPAC name of N-tert-butyl-3-[[5-(2,2-dimethylpropoxy)-2-pyridinyl]methyl]cyclobutan-1-amine (CID 177124053) is N-tert-butyl-3-[[5-(2,2-dimethylpropoxy)-2-pyridinyl]methyl]cyclobutan-1-amine.
What is the SMILES notation for N-tert-butyl-3-[[5-(2,2-dimethylpropoxy)-2-pyridinyl]methyl]cyclobutan-1-amine?
The canonical SMILES for N-tert-butyl-3-[[5-(2,2-dimethylpropoxy)-2-pyridinyl]methyl]cyclobutan-1-amine is CC(C)(C)COc1ccc(CC2CC(NC(C)(C)C)C2)nc1.
What is the InChIKey of N-tert-butyl-3-[[5-(2,2-dimethylpropoxy)-2-pyridinyl]methyl]cyclobutan-1-amine?
The InChIKey is XBOMPZMSDLVMGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32N2O/c1-18(2,3)13-22-17-8-7-15(20-12-17)9-14-10-16(11-14)21-19(4,5)6/h7-8,12,14,16,21H,9-11,13H2,1-6H3.
What are the key properties of N-tert-butyl-3-[[5-(2,2-dimethylpropoxy)-2-pyridinyl]methyl]cyclobutan-1-amine?
N-tert-butyl-3-[[5-(2,2-dimethylpropoxy)-2-pyridinyl]methyl]cyclobutan-1-amine has a molecular weight of 304.48 g/mol, XLogP of 4.22, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-3-[[5-(2,2-dimethylpropoxy)-2-pyridinyl]methyl]cyclobutan-1-amine is sourced from PubChem (CID 177124053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).