C16H11ClF2N6O — CID 177125103
6-chloro-3-[[3-[4-(difluoromethyl)phenyl]-5-methyltriazol-4-yl]methoxy]-4-isocyanopyridazine (PubChem CID 177125103) has the molecular formula C16H11ClF2N6O and a molecular weight of 376.75 g/mol. Its IUPAC name is 6-chloro-3-[[3-[4-(difluoromethyl)phenyl]-5-methyltriazol-4-yl]methoxy]-4-isocyanopyridazine.
| Compound Name | 6-chloro-3-[[3-[4-(difluoromethyl)phenyl]-5-methyltriazol-4-yl]methoxy]-4-isocyanopyridazine |
|---|---|
| PubChem CID | 177125103 |
| Molecular Formula | C16H11ClF2N6O |
| Molecular Weight | 376.75 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | 6-chloro-3-[[3-[4-(difluoromethyl)phenyl]-5-methyltriazol-4-yl]methoxy]-4-isocyanopyridazine |
| SMILES | [C-]#[N+]c1cc(Cl)nnc1OCc1c(C)nnn1-c1ccc(C(F)F)cc1 |
| InChI | InChI=1S/C16H11ClF2N6O/c1-9-13(8-26-16-12(20-2)7-14(17)22-23-16)25(24-21-9)11-5-3-10(4-6-11)15(18)19/h3-7,15H,8H2,1H3 |
| InChIKey | FKVBXPANWSEISI-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 70.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.75 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|