C19H35N3O3 — CID 177140557
tert-butyl 2-methyl-4-[(Z)-5-(methylamino)-1-oxooct-5-en-2-yl]piperazine-1-carboxylate (PubChem CID 177140557) has the molecular formula C19H35N3O3 and a molecular weight of 353.51 g/mol. Its IUPAC name is tert-butyl 2-methyl-4-[(Z)-5-(methylamino)-1-oxooct-5-en-2-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 2-methyl-4-[(Z)-5-(methylamino)-1-oxooct-5-en-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 177140557 |
| Molecular Formula | C19H35N3O3 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.27 |
| IUPAC Name | tert-butyl 2-methyl-4-[(Z)-5-(methylamino)-1-oxooct-5-en-2-yl]piperazine-1-carboxylate |
| SMILES | CC/C=C(/CCC(C=O)N1CCN(C(=O)OC(C)(C)C)C(C)C1)NC |
| InChI | InChI=1S/C19H35N3O3/c1-7-8-16(20-6)9-10-17(14-23)21-11-12-22(15(2)13-21)18(24)25-19(3,4)5/h8,14-15,17,20H,7,9-13H2,1-6H3/b16-8- |
| InChIKey | QJVWLUYBSNLISE-PXNMLYILSA-N |
| XLogP | 2.79 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|