C20H24O3 — CID 177141022
2-[3-[(3E)-4-phenylmethoxyhexa-1,3,5-trien-2-yl]cyclopentyl]acetic acid (PubChem CID 177141022) has the molecular formula C20H24O3 and a molecular weight of 312.41 g/mol. Its IUPAC name is 2-[3-[(3E)-4-phenylmethoxyhexa-1,3,5-trien-2-yl]cyclopentyl]acetic acid.
| Compound Name | 2-[3-[(3E)-4-phenylmethoxyhexa-1,3,5-trien-2-yl]cyclopentyl]acetic acid |
|---|---|
| PubChem CID | 177141022 |
| Molecular Formula | C20H24O3 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 2-[3-[(3E)-4-phenylmethoxyhexa-1,3,5-trien-2-yl]cyclopentyl]acetic acid |
| SMILES | C=C/C(=C\C(=C)C1CCC(CC(=O)O)C1)OCc1ccccc1 |
| InChI | InChI=1S/C20H24O3/c1-3-19(23-14-16-7-5-4-6-8-16)11-15(2)18-10-9-17(12-18)13-20(21)22/h3-8,11,17-18H,1-2,9-10,12-14H2,(H,21,22)/b19-11+ |
| InChIKey | LGIZOYOXWNRNLO-YBFXNURJSA-N |
| XLogP | 4.72 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|