C11H16N3O3S+ — CID 177144771
[6-ethyl-4-[[1-(hydroxymethyl)cyclobutyl]amino]-2-oxo-1H-pyrimidin-5-yl]-oxosulfanium (PubChem CID 177144771) has the molecular formula C11H16N3O3S+ and a molecular weight of 270.33 g/mol. Its IUPAC name is [6-ethyl-4-[[1-(hydroxymethyl)cyclobutyl]amino]-2-oxo-1H-pyrimidin-5-yl]-oxosulfanium.
| Compound Name | [6-ethyl-4-[[1-(hydroxymethyl)cyclobutyl]amino]-2-oxo-1H-pyrimidin-5-yl]-oxosulfanium |
|---|---|
| PubChem CID | 177144771 |
| Molecular Formula | C11H16N3O3S+ |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | [6-ethyl-4-[[1-(hydroxymethyl)cyclobutyl]amino]-2-oxo-1H-pyrimidin-5-yl]-oxosulfanium |
| SMILES | CCc1[nH]c(=O)nc(NC2(CO)CCC2)c1[S+]=O |
| InChI | InChI=1S/C11H15N3O3S/c1-2-7-8(18-17)9(13-10(16)12-7)14-11(6-15)4-3-5-11/h15H,2-6H2,1H3,(H-,12,13,14,16,17)/p+1 |
| InChIKey | HLXTZAQSHMZQDE-UHFFFAOYSA-O |
| XLogP | 0.45 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|