C9H13N3 — CID 177145905
(2Z)-2-(1-methylimidazol-2-yl)penta-2,4-dien-1-amine (PubChem CID 177145905) has the molecular formula C9H13N3 and a molecular weight of 163.22 g/mol. Its IUPAC name is (2Z)-2-(1-methylimidazol-2-yl)penta-2,4-dien-1-amine.
| Compound Name | (2Z)-2-(1-methylimidazol-2-yl)penta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 177145905 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | (2Z)-2-(1-methylimidazol-2-yl)penta-2,4-dien-1-amine |
| SMILES | C=C/C=C(/CN)c1nccn1C |
| InChI | InChI=1S/C9H13N3/c1-3-4-8(7-10)9-11-5-6-12(9)2/h3-6H,1,7,10H2,2H3/b8-4- |
| InChIKey | VYKDATZHBDFCMV-YWEYNIOJSA-N |
| XLogP | 0.95 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|