C8H11N3O — CID 167047168
prop-2-enyl 1-methylimidazole-2-carboximidate (PubChem CID 167047168) has the molecular formula C8H11N3O and a molecular weight of 165.20 g/mol. Its IUPAC name is prop-2-enyl 1-methylimidazole-2-carboximidate.
| Compound Name | prop-2-enyl 1-methylimidazole-2-carboximidate |
|---|---|
| PubChem CID | 167047168 |
| Molecular Formula | C8H11N3O |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | prop-2-enyl 1-methylimidazole-2-carboximidate |
| SMILES | [H]/N=C(\OCC=C)c1nccn1C |
| InChI | InChI=1S/C8H11N3O/c1-3-6-12-7(9)8-10-4-5-11(8)2/h3-5,9H,1,6H2,2H3/b9-7- |
| InChIKey | XOEZVYOFBQKFDC-CLFYSBASSA-N |
| XLogP | 0.95 |
| TPSA | 50.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|