C21H19N7O2 — CID 138515257
[(E)-N'-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)carbamimidoyl] 1-methylimidazole-2-carboximidate (PubChem CID 138515257) has the molecular formula C21H19N7O2 and a molecular weight of 401.43 g/mol. Its IUPAC name is [(E)-N'-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)carbamimidoyl] 1-methylimidazole-2-carboximidate.
| Compound Name | [(E)-N'-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)carbamimidoyl] 1-methylimidazole-2-carboximidate |
|---|---|
| PubChem CID | 138515257 |
| Molecular Formula | C21H19N7O2 |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | [(E)-N'-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)carbamimidoyl] 1-methylimidazole-2-carboximidate |
| SMILES | [H]/N=C(/O/C(N)=N/C1N=C(c2ccccc2)c2ccccc2NC1=O)c1nccn1C |
| InChI | InChI=1S/C21H19N7O2/c1-28-12-11-24-19(28)17(22)30-21(23)27-18-20(29)25-15-10-6-5-9-14(15)16(26-18)13-7-3-2-4-8-13/h2-12,18,22H,1H3,(H2,23,27)(H,25,29)/b22-17+ |
| InChIKey | PEYQPISKDLKOFM-OQKWZONESA-N |
| XLogP | 1.89 |
| TPSA | 130.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|