C24H24N6O3 — CID 138514832
[(E)-N'-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)carbamimidoyl] 5-[(dimethylamino)methyl]furan-2-carboximidate (PubChem CID 138514832) has the molecular formula C24H24N6O3 and a molecular weight of 444.50 g/mol. Its IUPAC name is [(E)-N'-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)carbamimidoyl] 5-[(dimethylamino)methyl]furan-2-carboximidate.
| Compound Name | [(E)-N'-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)carbamimidoyl] 5-[(dimethylamino)methyl]furan-2-carboximidate |
|---|---|
| PubChem CID | 138514832 |
| Molecular Formula | C24H24N6O3 |
| Molecular Weight | 444.50 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | [(E)-N'-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)carbamimidoyl] 5-[(dimethylamino)methyl]furan-2-carboximidate |
| SMILES | [H]/N=C(/O/C(N)=N/C1N=C(c2ccccc2)c2ccccc2NC1=O)c1ccc(CN(C)C)o1 |
| InChI | InChI=1S/C24H24N6O3/c1-30(2)14-16-12-13-19(32-16)21(25)33-24(26)29-22-23(31)27-18-11-7-6-10-17(18)20(28-22)15-8-4-3-5-9-15/h3-13,22,25H,14H2,1-2H3,(H2,26,29)(H,27,31)/b25-21+ |
| InChIKey | ILGFEIPWVGPDKJ-NJNXFGOHSA-N |
| XLogP | 2.81 |
| TPSA | 129.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.50 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|