C24H20N8O2 — CID 145236414
[(E)-N'-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)carbamimidoyl] 4-(N-iminocarbamimidoyl)benzenecarboximidate (PubChem CID 145236414) has the molecular formula C24H20N8O2 and a molecular weight of 452.48 g/mol. Its IUPAC name is [(E)-N'-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)carbamimidoyl] 4-(N-iminocarbamimidoyl)benzenecarboximidate.
| Compound Name | [(E)-N'-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)carbamimidoyl] 4-(N-iminocarbamimidoyl)benzenecarboximidate |
|---|---|
| PubChem CID | 145236414 |
| Molecular Formula | C24H20N8O2 |
| Molecular Weight | 452.48 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | [(E)-N'-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)carbamimidoyl] 4-(N-iminocarbamimidoyl)benzenecarboximidate |
| SMILES | [H]/N=C(\N=N\[H])c1ccc(/C(=N\[H])O/C(N)=N/C2N=C(c3ccccc3)c3ccccc3NC2=O)cc1 |
| InChI | InChI=1S/C24H20N8O2/c25-20(32-28)15-10-12-16(13-11-15)21(26)34-24(27)31-22-23(33)29-18-9-5-4-8-17(18)19(30-22)14-6-2-1-3-7-14/h1-13,22,25-26,28H,(H2,27,31)(H,29,33)/b25-20-,26-21+,32-28+ |
| InChIKey | ARELQDLGOZAKKO-GBXLCABISA-N |
| XLogP | 3.52 |
| TPSA | 172.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.48 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|