C25H20N6O2S — CID 138515362
[(E)-N'-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)carbamimidoyl] 2-methyl-1,3-benzothiazole-6-carboximidate (PubChem CID 138515362) has the molecular formula C25H20N6O2S and a molecular weight of 468.54 g/mol. Its IUPAC name is [(E)-N'-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)carbamimidoyl] 2-methyl-1,3-benzothiazole-6-carboximidate.
| Compound Name | [(E)-N'-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)carbamimidoyl] 2-methyl-1,3-benzothiazole-6-carboximidate |
|---|---|
| PubChem CID | 138515362 |
| Molecular Formula | C25H20N6O2S |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | [(E)-N'-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)carbamimidoyl] 2-methyl-1,3-benzothiazole-6-carboximidate |
| SMILES | [H]/N=C(/O/C(N)=N/C1N=C(c2ccccc2)c2ccccc2NC1=O)c1ccc2nc(C)sc2c1 |
| InChI | InChI=1S/C25H20N6O2S/c1-14-28-19-12-11-16(13-20(19)34-14)22(26)33-25(27)31-23-24(32)29-18-10-6-5-9-17(18)21(30-23)15-7-3-2-4-8-15/h2-13,23,26H,1H3,(H2,27,31)(H,29,32)/b26-22+ |
| InChIKey | BUNQIWQSAFGDEE-XTCLZLMSSA-N |
| XLogP | 4.08 |
| TPSA | 125.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|