C9H13N3O — CID 167047156
but-3-enyl 1-methylimidazole-2-carboximidate (PubChem CID 167047156) has the molecular formula C9H13N3O and a molecular weight of 179.22 g/mol. Its IUPAC name is but-3-enyl 1-methylimidazole-2-carboximidate.
| Compound Name | but-3-enyl 1-methylimidazole-2-carboximidate |
|---|---|
| PubChem CID | 167047156 |
| Molecular Formula | C9H13N3O |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | but-3-enyl 1-methylimidazole-2-carboximidate |
| SMILES | [H]/N=C(\OCCC=C)c1nccn1C |
| InChI | InChI=1S/C9H13N3O/c1-3-4-7-13-8(10)9-11-5-6-12(9)2/h3,5-6,10H,1,4,7H2,2H3/b10-8- |
| InChIKey | IKZDWTBRQOROHM-NTMALXAHSA-N |
| XLogP | 1.34 |
| TPSA | 50.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|