C25H41N3O3 — CID 177146147
tert-butyl N-[2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-oxoethyl]carbamate;N,N-dimethyl-1-phenylmethanamine (PubChem CID 177146147) has the molecular formula C25H41N3O3 and a molecular weight of 431.62 g/mol. Its IUPAC name is tert-butyl N-[2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-oxoethyl]carbamate;N,N-dimethyl-1-phenylmethanamine.
| Compound Name | tert-butyl N-[2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-oxoethyl]carbamate;N,N-dimethyl-1-phenylmethanamine |
|---|---|
| PubChem CID | 177146147 |
| Molecular Formula | C25H41N3O3 |
| Molecular Weight | 431.62 g/mol |
| Exact Mass | 431.31 |
| IUPAC Name | tert-butyl N-[2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-oxoethyl]carbamate;N,N-dimethyl-1-phenylmethanamine |
| SMILES | CC(C)(C)OC(=O)NCC(=O)N1CCCC2CCCCC21.CN(C)Cc1ccccc1 |
| InChI | InChI=1S/C16H28N2O3.C9H13N/c1-16(2,3)21-15(20)17-11-14(19)18-10-6-8-12-7-4-5-9-13(12)18;1-10(2)8-9-6-4-3-5-7-9/h12-13H,4-11H2,1-3H3,(H,17,20);3-7H,8H2,1-2H3 |
| InChIKey | PCZZCMQHXRYOQF-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.62 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |